C25H24BrN3O3S — CID 59767084
4-bromo-10-(4-methoxyphenyl)-13-(oxolan-2-ylmethyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 59767084) has the molecular formula C25H24BrN3O3S and a molecular weight of 526.46 g/mol. Its IUPAC name is 4-bromo-10-(4-methoxyphenyl)-13-(oxolan-2-ylmethyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | 4-bromo-10-(4-methoxyphenyl)-13-(oxolan-2-ylmethyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 59767084 |
| Molecular Formula | C25H24BrN3O3S |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 4-bromo-10-(4-methoxyphenyl)-13-(oxolan-2-ylmethyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Br)cc4c3CC3C(=O)N(CC4CCCO4)C(=S)N32)cc1 |
| InChI | InChI=1S/C25H24BrN3O3S/c1-31-16-7-4-14(5-8-16)23-22-19(18-11-15(26)6-9-20(18)27-22)12-21-24(30)28(25(33)29(21)23)13-17-3-2-10-32-17/h4-9,11,17,21,23,27H,2-3,10,12-13H2,1H3 |
| InChIKey | WWOAYYDNJHTTLU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|