C26H22BrN5O2 — CID 59767087
4-bromo-13-propan-2-yl-10-(4-pyrimidin-5-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 59767087) has the molecular formula C26H22BrN5O2 and a molecular weight of 516.40 g/mol. Its IUPAC name is 4-bromo-13-propan-2-yl-10-(4-pyrimidin-5-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 4-bromo-13-propan-2-yl-10-(4-pyrimidin-5-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 59767087 |
| Molecular Formula | C26H22BrN5O2 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 4-bromo-13-propan-2-yl-10-(4-pyrimidin-5-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CC(C)N1C(=O)C2Cc3c([nH]c4ccc(Br)cc34)C(c3ccc(-c4cncnc4)cc3)N2C1=O |
| InChI | InChI=1S/C26H22BrN5O2/c1-14(2)31-25(33)22-10-20-19-9-18(27)7-8-21(19)30-23(20)24(32(22)26(31)34)16-5-3-15(4-6-16)17-11-28-13-29-12-17/h3-9,11-14,22,24,30H,10H2,1-2H3 |
| InChIKey | PINUPACFMRQTJW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|