C29H33BrN4O3S — CID 59767093
4-bromo-10-[4-(3-morpholin-4-ylpropoxy)phenyl]-13-propan-2-yl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 59767093) has the molecular formula C29H33BrN4O3S and a molecular weight of 597.58 g/mol. Its IUPAC name is 4-bromo-10-[4-(3-morpholin-4-ylpropoxy)phenyl]-13-propan-2-yl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | 4-bromo-10-[4-(3-morpholin-4-ylpropoxy)phenyl]-13-propan-2-yl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 59767093 |
| Molecular Formula | C29H33BrN4O3S |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 4-bromo-10-[4-(3-morpholin-4-ylpropoxy)phenyl]-13-propan-2-yl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | CC(C)N1C(=O)C2Cc3c([nH]c4ccc(Br)cc34)C(c3ccc(OCCCN4CCOCC4)cc3)N2C1=S |
| InChI | InChI=1S/C29H33BrN4O3S/c1-18(2)33-28(35)25-17-23-22-16-20(30)6-9-24(22)31-26(23)27(34(25)29(33)38)19-4-7-21(8-5-19)37-13-3-10-32-11-14-36-15-12-32/h4-9,16,18,25,27,31H,3,10-15,17H2,1-2H3 |
| InChIKey | BFUVTRGTLLTOKU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|