C25H22ClN5O2 — CID 59767174
4-chloro-10-(4-imidazol-1-ylphenyl)-13-propan-2-yl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 59767174) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is 4-chloro-10-(4-imidazol-1-ylphenyl)-13-propan-2-yl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 4-chloro-10-(4-imidazol-1-ylphenyl)-13-propan-2-yl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 59767174 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 4-chloro-10-(4-imidazol-1-ylphenyl)-13-propan-2-yl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CC(C)N1C(=O)C2Cc3c([nH]c4ccc(Cl)cc34)C(c3ccc(-n4ccnc4)cc3)N2C1=O |
| InChI | InChI=1S/C25H22ClN5O2/c1-14(2)30-24(32)21-12-19-18-11-16(26)5-8-20(18)28-22(19)23(31(21)25(30)33)15-3-6-17(7-4-15)29-10-9-27-13-29/h3-11,13-14,21,23,28H,12H2,1-2H3 |
| InChIKey | LEMKWNDGZSQHDY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|