C24H40O5Si — CID 59767975
(4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one (PubChem CID 59767975) has the molecular formula C24H40O5Si and a molecular weight of 436.67 g/mol. Its IUPAC name is (4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 59767975 |
| Molecular Formula | C24H40O5Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (4R,6R)-6-[2-[(1S,2S,6R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one |
| SMILES | C[C@H]1C=CC2=C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H]2[C@H]1CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C24H40O5Si/c1-15-7-8-16-11-19(29-30(5,6)24(2,3)4)14-21(26)23(16)20(15)10-9-18-12-17(25)13-22(27)28-18/h7-8,11,15,17-21,23,25-26H,9-10,12-14H2,1-6H3/t15-,17+,18+,19-,20-,21-,23-/m0/s1 |
| InChIKey | RKLRMUQZAVOTSD-IZODTOOQSA-N |
| XLogP | 4.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|