About 4-methoxy-1,2,2-trimethylpyrrolidine
4-methoxy-1,2,2-trimethylpyrrolidine (PubChem CID 59768170) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-methoxy-1,2,2-trimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-methoxy-1,2,2-trimethylpyrrolidine |
| PubChem CID | 59768170 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 4-methoxy-1,2,2-trimethylpyrrolidine |
| SMILES | COC1CN(C)C(C)(C)C1 |
| InChI | InChI=1S/C8H17NO/c1-8(2)5-7(10-4)6-9(8)3/h7H,5-6H2,1-4H3 |
| InChIKey | BCFVUJHKSFUEMZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-1,2,2-trimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,2,2-trimethylpyrrolidine?
The IUPAC name of 4-methoxy-1,2,2-trimethylpyrrolidine (CID 59768170) is 4-methoxy-1,2,2-trimethylpyrrolidine.
What is the SMILES notation for 4-methoxy-1,2,2-trimethylpyrrolidine?
The canonical SMILES for 4-methoxy-1,2,2-trimethylpyrrolidine is COC1CN(C)C(C)(C)C1.
What is the InChIKey of 4-methoxy-1,2,2-trimethylpyrrolidine?
The InChIKey is BCFVUJHKSFUEMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-8(2)5-7(10-4)6-9(8)3/h7H,5-6H2,1-4H3.
What are the key properties of 4-methoxy-1,2,2-trimethylpyrrolidine?
4-methoxy-1,2,2-trimethylpyrrolidine has a molecular weight of 143.23 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,2,2-trimethylpyrrolidine is sourced from PubChem (CID 59768170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).