About 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde
4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde (PubChem CID 59768293) has the molecular formula C17H13NO4S
and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde.
Molecular Properties
| Compound Name | 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde |
| PubChem CID | 59768293 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde |
| SMILES | O=Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C17H13NO4S/c19-10-12-3-7-14(8-4-12)22-13-5-1-11(2-6-13)9-15-16(20)18-17(21)23-15/h1-8,10,15H,9H2,(H,18,20,21) |
| InChIKey | PUUZILKFHHYHPH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde?
The IUPAC name of 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde (CID 59768293) is 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde.
What is the SMILES notation for 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde?
The canonical SMILES for 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde is O=Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1.
What is the InChIKey of 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde?
The InChIKey is PUUZILKFHHYHPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO4S/c19-10-12-3-7-14(8-4-12)22-13-5-1-11(2-6-13)9-15-16(20)18-17(21)23-15/h1-8,10,15H,9H2,(H,18,20,21).
What are the key properties of 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde?
4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde has a molecular weight of 327.36 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]benzaldehyde is sourced from PubChem (CID 59768293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).