C23H30N4O — CID 59768389
(E)-3-[4-[(tert-butylamino)methyl]phenyl]-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 59768389) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (E)-3-[4-[(tert-butylamino)methyl]phenyl]-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-[(tert-butylamino)methyl]phenyl]-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59768389 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (E)-3-[4-[(tert-butylamino)methyl]phenyl]-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CC(C)(C)NCc1ccc(/C=C/C(=O)N2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O/c1-23(2,3)25-18-20-9-7-19(8-10-20)11-12-22(28)27-16-14-26(15-17-27)21-6-4-5-13-24-21/h4-13,25H,14-18H2,1-3H3/b12-11+ |
| InChIKey | JFDBCYMIRCJDRG-VAWYXSNFSA-N |
| XLogP | 3.33 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|