C43H34F10O10 — CID 59768968
[4-[3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2-(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 59768968) has the molecular formula C43H34F10O10 and a molecular weight of 900.71 g/mol. Its IUPAC name is [4-[3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2-(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2-(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 59768968 |
| Molecular Formula | C43H34F10O10 |
| Molecular Weight | 900.71 g/mol |
| Exact Mass | 900.20 |
| IUPAC Name | [4-[3-fluoro-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2-(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)c4ccc(OCCCCOC(=O)C=C)cc4)c(C(F)(F)F)c3C(F)(F)F)c(C(F)(F)F)c2F)cc1 |
| InChI | InChI=1S/C43H34F10O10/c1-3-33(54)60-23-7-5-21-58-27-13-9-25(10-14-27)39(56)62-31-19-17-29(35(41(45,46)47)37(31)43(51,52)53)30-18-20-32(38(44)36(30)42(48,49)50)63-40(57)26-11-15-28(16-12-26)59-22-6-8-24-61-34(55)4-2/h3-4,9-20H,1-2,5-8,21-24H2 |
| InChIKey | BWMJZCROOYVGAA-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.71 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|