C19H16ClF3N4 — CID 59769242
6-chloro-N-cyclohexyl-7-(2,4,6-trifluorophenyl)pyrido[2,3-b]pyrazin-8-amine (PubChem CID 59769242) has the molecular formula C19H16ClF3N4 and a molecular weight of 392.81 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-7-(2,4,6-trifluorophenyl)pyrido[2,3-b]pyrazin-8-amine.
| Compound Name | 6-chloro-N-cyclohexyl-7-(2,4,6-trifluorophenyl)pyrido[2,3-b]pyrazin-8-amine |
|---|---|
| PubChem CID | 59769242 |
| Molecular Formula | C19H16ClF3N4 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-chloro-N-cyclohexyl-7-(2,4,6-trifluorophenyl)pyrido[2,3-b]pyrazin-8-amine |
| SMILES | Fc1cc(F)c(-c2c(Cl)nc3nccnc3c2NC2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C19H16ClF3N4/c20-18-15(14-12(22)8-10(21)9-13(14)23)16(26-11-4-2-1-3-5-11)17-19(27-18)25-7-6-24-17/h6-9,11H,1-5H2,(H,25,26,27) |
| InChIKey | XEGBQCMWDLNSKW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|