About 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium
4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium (PubChem CID 59769719) has the molecular formula C16H19N2O4UV-
and a molecular weight of 592.31 g/mol. Its IUPAC name is 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium.
Molecular Properties
| Compound Name | 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium |
| PubChem CID | 59769719 |
| Molecular Formula | C16H19N2O4UV- |
| Molecular Weight | 592.31 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium |
| SMILES | O=C(O)c1ccc(CCN2C(=O)CCN2C/C=C\[CH-]O)cc1.[U].[V] |
| InChI | InChI=1S/C16H19N2O4.U.V/c19-12-2-1-9-17-10-8-15(20)18(17)11-7-13-3-5-14(6-4-13)16(21)22;;/h1-6,12,19H,7-11H2,(H,21,22);;/q-1;;/b2-1-;; |
| InChIKey | UKAXKBDYHYHJNJ-UAIGNFCESA-N |
| XLogP | 1.46 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 592.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium?
The IUPAC name of 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium (CID 59769719) is 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium.
What is the SMILES notation for 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium?
The canonical SMILES for 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium is O=C(O)c1ccc(CCN2C(=O)CCN2C/C=C\[CH-]O)cc1.[U].[V].
What is the InChIKey of 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium?
The InChIKey is UKAXKBDYHYHJNJ-UAIGNFCESA-N. The full InChI is InChI=1S/C16H19N2O4.U.V/c19-12-2-1-9-17-10-8-15(20)18(17)11-7-13-3-5-14(6-4-13)16(21)22;;/h1-6,12,19H,7-11H2,(H,21,22);;/q-1;;/b2-1-;;.
What are the key properties of 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium?
4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium has a molecular weight of 592.31 g/mol, XLogP of 1.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-[(Z)-4-hydroxybut-2-enyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid;uranium;vanadium is sourced from PubChem (CID 59769719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).