About [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone
[6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone (PubChem CID 59769739) has the molecular formula C16H13F2N3O3
and a molecular weight of 333.29 g/mol. Its IUPAC name is [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone.
Molecular Properties
| Compound Name | [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone |
| PubChem CID | 59769739 |
| Molecular Formula | C16H13F2N3O3 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone |
| SMILES | COc1ccc2c(C(=O)c3ccc(C(F)(F)CO)nc3)n[nH]c2c1 |
| InChI | InChI=1S/C16H13F2N3O3/c1-24-10-3-4-11-12(6-10)20-21-14(11)15(23)9-2-5-13(19-7-9)16(17,18)8-22/h2-7,22H,8H2,1H3,(H,20,21) |
| InChIKey | JIJMOGYKYCZIQE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone?
The IUPAC name of [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone (CID 59769739) is [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone.
What is the SMILES notation for [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone?
The canonical SMILES for [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone is COc1ccc2c(C(=O)c3ccc(C(F)(F)CO)nc3)n[nH]c2c1.
What is the InChIKey of [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone?
The InChIKey is JIJMOGYKYCZIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2N3O3/c1-24-10-3-4-11-12(6-10)20-21-14(11)15(23)9-2-5-13(19-7-9)16(17,18)8-22/h2-7,22H,8H2,1H3,(H,20,21).
What are the key properties of [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone?
[6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone has a molecular weight of 333.29 g/mol, XLogP of 2.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,1-difluoro-2-hydroxyethyl)-3-pyridinyl]-(6-methoxy-1H-indazol-3-yl)methanone is sourced from PubChem (CID 59769739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).