About ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate
ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate (PubChem CID 59769783) has the molecular formula C16H13ClF2O2S3
and a molecular weight of 406.93 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate |
| PubChem CID | 59769783 |
| Molecular Formula | C16H13ClF2O2S3 |
| Molecular Weight | 406.93 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate |
| SMILES | CCOC(=O)C(c1cc(F)ccc1F)S(=S)(=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClF2O2S3/c1-2-21-16(20)15(13-9-11(18)5-8-14(13)19)24(22,23)12-6-3-10(17)4-7-12/h3-9,15H,2H2,1H3 |
| InChIKey | VDLFFMAGVDNWPW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.93 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate?
The IUPAC name of ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate (CID 59769783) is ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate.
What is the SMILES notation for ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate?
The canonical SMILES for ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate is CCOC(=O)C(c1cc(F)ccc1F)S(=S)(=S)c1ccc(Cl)cc1.
What is the InChIKey of ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate?
The InChIKey is VDLFFMAGVDNWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF2O2S3/c1-2-21-16(20)15(13-9-11(18)5-8-14(13)19)24(22,23)12-6-3-10(17)4-7-12/h3-9,15H,2H2,1H3.
What are the key properties of ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate?
ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate has a molecular weight of 406.93 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-chlorophenyl)sulfonodithioyl-2-(2,5-difluorophenyl)acetate is sourced from PubChem (CID 59769783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).