About 1-methylimidazole-4,5-dicarboxamide
1-methylimidazole-4,5-dicarboxamide (PubChem CID 597698) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is 1-methylimidazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-methylimidazole-4,5-dicarboxamide |
| PubChem CID | 597698 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 1-methylimidazole-4,5-dicarboxamide |
| SMILES | Cn1cnc(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C6H8N4O2/c1-10-2-9-3(5(7)11)4(10)6(8)12/h2H,1H3,(H2,7,11)(H2,8,12) |
| InChIKey | YSIRHNSNQUYYME-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylimidazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazole-4,5-dicarboxamide?
The IUPAC name of 1-methylimidazole-4,5-dicarboxamide (CID 597698) is 1-methylimidazole-4,5-dicarboxamide.
What is the SMILES notation for 1-methylimidazole-4,5-dicarboxamide?
The canonical SMILES for 1-methylimidazole-4,5-dicarboxamide is Cn1cnc(C(N)=O)c1C(N)=O.
What is the InChIKey of 1-methylimidazole-4,5-dicarboxamide?
The InChIKey is YSIRHNSNQUYYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c1-10-2-9-3(5(7)11)4(10)6(8)12/h2H,1H3,(H2,7,11)(H2,8,12).
What are the key properties of 1-methylimidazole-4,5-dicarboxamide?
1-methylimidazole-4,5-dicarboxamide has a molecular weight of 168.16 g/mol, XLogP of -1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazole-4,5-dicarboxamide is sourced from PubChem (CID 597698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).