C26H26N2O8S2 — CID 59769822
2-[[3-[[3,3-dimethyl-5-(trioxidanylsulfanyl)-1H-indol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-1,2-dihydroindole-5-sulfonic acid (PubChem CID 59769822) has the molecular formula C26H26N2O8S2 and a molecular weight of 558.63 g/mol. Its IUPAC name is 2-[[3-[[3,3-dimethyl-5-(trioxidanylsulfanyl)-1H-indol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-1,2-dihydroindole-5-sulfonic acid.
| Compound Name | 2-[[3-[[3,3-dimethyl-5-(trioxidanylsulfanyl)-1H-indol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-1,2-dihydroindole-5-sulfonic acid |
|---|---|
| PubChem CID | 59769822 |
| Molecular Formula | C26H26N2O8S2 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 2-[[3-[[3,3-dimethyl-5-(trioxidanylsulfanyl)-1H-indol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-1,2-dihydroindole-5-sulfonic acid |
| SMILES | CC1(C)C(=CC2=C(O)C(=CC3Nc4ccc(S(=O)(=O)O)cc4C3(C)C)C2=O)Nc2ccc(SOOO)cc21 |
| InChI | InChI=1S/C26H26N2O8S2/c1-25(2)17-9-13(37-36-35-31)5-7-19(17)27-21(25)11-15-23(29)16(24(15)30)12-22-26(3,4)18-10-14(38(32,33)34)6-8-20(18)28-22/h5-12,22,27-29,31H,1-4H3,(H,32,33,34) |
| InChIKey | PPBDCGSIBBMTIR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|