C35H32F3NO2S — CID 59770127
1-[5-methyl-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]sulfonyl-4-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 59770127) has the molecular formula C35H32F3NO2S and a molecular weight of 587.71 g/mol. Its IUPAC name is 1-[5-methyl-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]sulfonyl-4-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 1-[5-methyl-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]sulfonyl-4-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 59770127 |
| Molecular Formula | C35H32F3NO2S |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 1-[5-methyl-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]sulfonyl-4-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | Cc1ccc(C=C2c3ccccc3CCc3ccccc32)c(S(=O)(=O)N2CCC(c3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C35H32F3NO2S/c1-24-10-11-29(23-33-31-8-4-2-6-27(31)12-13-28-7-3-5-9-32(28)33)34(22-24)42(40,41)39-20-18-26(19-21-39)25-14-16-30(17-15-25)35(36,37)38/h2-11,14-17,22-23,26H,12-13,18-21H2,1H3 |
| InChIKey | IOSVOXMOQQCQGC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|