C28H29NO3S — CID 59770317
N-[3-[(1Z)-1-[6-(cyclopropylmethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]phenyl]methanesulfonamide (PubChem CID 59770317) has the molecular formula C28H29NO3S and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[3-[(1Z)-1-[6-(cyclopropylmethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(1Z)-1-[6-(cyclopropylmethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59770317 |
| Molecular Formula | C28H29NO3S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[3-[(1Z)-1-[6-(cyclopropylmethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]phenyl]methanesulfonamide |
| SMILES | C/C(=C1\c2ccccc2CCc2cc(OCC3CC3)ccc21)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H29NO3S/c1-19(22-7-5-8-24(16-22)29-33(2,30)31)28-26-9-4-3-6-21(26)12-13-23-17-25(14-15-27(23)28)32-18-20-10-11-20/h3-9,14-17,20,29H,10-13,18H2,1-2H3/b28-19- |
| InChIKey | IBNHNZJXAUVAPO-USHMODERSA-N |
| XLogP | 5.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|