C23H21NO2S — CID 59770543
N-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]methanesulfonamide (PubChem CID 59770543) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59770543 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidenemethyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C=C2c3ccccc3CCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H21NO2S/c1-27(25,26)24-20-14-10-17(11-15-20)16-23-21-8-4-2-6-18(21)12-13-19-7-3-5-9-22(19)23/h2-11,14-16,24H,12-13H2,1H3 |
| InChIKey | AZIDXGQGLZQBNU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|