C48H96O18 — CID 59770611
4,8,11,15,19,22,26,30,33-nonamethyl-2,6,13,17,24,28-hexa(propan-2-yloxy)-1,3,5,7,12,14,16,18,23,25,27,29-dodecaoxacyclotritriacontane (PubChem CID 59770611) has the molecular formula C48H96O18 and a molecular weight of 961.28 g/mol. Its IUPAC name is 4,8,11,15,19,22,26,30,33-nonamethyl-2,6,13,17,24,28-hexa(propan-2-yloxy)-1,3,5,7,12,14,16,18,23,25,27,29-dodecaoxacyclotritriacontane.
| Compound Name | 4,8,11,15,19,22,26,30,33-nonamethyl-2,6,13,17,24,28-hexa(propan-2-yloxy)-1,3,5,7,12,14,16,18,23,25,27,29-dodecaoxacyclotritriacontane |
|---|---|
| PubChem CID | 59770611 |
| Molecular Formula | C48H96O18 |
| Molecular Weight | 961.28 g/mol |
| Exact Mass | 960.66 |
| IUPAC Name | 4,8,11,15,19,22,26,30,33-nonamethyl-2,6,13,17,24,28-hexa(propan-2-yloxy)-1,3,5,7,12,14,16,18,23,25,27,29-dodecaoxacyclotritriacontane |
| SMILES | CC(C)OC1OC(C)CCC(C)OC(OC(C)C)OC(C)OC(OC(C)C)OC(C)CCC(C)OC(OC(C)C)OC(C)OC(OC(C)C)OC(C)CCC(C)OC(OC(C)C)OC(C)O1 |
| InChI | InChI=1S/C48H96O18/c1-28(2)49-43-55-34(13)22-23-35(14)57-45(51-30(5)6)63-41(20)64-47(53-32(9)10)59-38(17)26-27-39(18)60-48(54-33(11)12)66-42(21)65-46(52-31(7)8)58-37(16)25-24-36(15)56-44(50-29(3)4)62-40(19)61-43/h28-48H,22-27H2,1-21H3 |
| InChIKey | QMDCOWQSBQJTAR-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 166.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.28 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |