C23H41N3O11 — CID 59770643
2-[2-acetyloxyethyl(2-oxopropyl)amino]ethyl 2-[2-oxo-2-[2-[2-[2-(propoxycarbonylamino)ethoxy]ethoxy]ethylamino]ethoxy]acetate (PubChem CID 59770643) has the molecular formula C23H41N3O11 and a molecular weight of 535.59 g/mol. Its IUPAC name is 2-[2-acetyloxyethyl(2-oxopropyl)amino]ethyl 2-[2-oxo-2-[2-[2-[2-(propoxycarbonylamino)ethoxy]ethoxy]ethylamino]ethoxy]acetate.
| Compound Name | 2-[2-acetyloxyethyl(2-oxopropyl)amino]ethyl 2-[2-oxo-2-[2-[2-[2-(propoxycarbonylamino)ethoxy]ethoxy]ethylamino]ethoxy]acetate |
|---|---|
| PubChem CID | 59770643 |
| Molecular Formula | C23H41N3O11 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 2-[2-acetyloxyethyl(2-oxopropyl)amino]ethyl 2-[2-oxo-2-[2-[2-[2-(propoxycarbonylamino)ethoxy]ethoxy]ethylamino]ethoxy]acetate |
| SMILES | CCCOC(=O)NCCOCCOCCNC(=O)COCC(=O)OCCN(CCOC(C)=O)CC(C)=O |
| InChI | InChI=1S/C23H41N3O11/c1-4-9-37-23(31)25-6-11-33-15-14-32-10-5-24-21(29)17-34-18-22(30)36-13-8-26(16-19(2)27)7-12-35-20(3)28/h4-18H2,1-3H3,(H,24,29)(H,25,31) |
| InChIKey | XLVZIAGZIYUPTC-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 168.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|