C31H50N4O13 — CID 59770656
2-[2-[2-[2-[2-[2-[2-(butoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]acetyl]oxyethyl-(2-oxopropyl)amino]ethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate (PubChem CID 59770656) has the molecular formula C31H50N4O13 and a molecular weight of 686.76 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(butoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]acetyl]oxyethyl-(2-oxopropyl)amino]ethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(butoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]acetyl]oxyethyl-(2-oxopropyl)amino]ethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate |
|---|---|
| PubChem CID | 59770656 |
| Molecular Formula | C31H50N4O13 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(butoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethoxy]acetyl]oxyethyl-(2-oxopropyl)amino]ethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| SMILES | CCCCOC(=O)NCCOCCOCCNC(=O)COCC(=O)OCCN(CCOC(=O)CCCCN1C(=O)C=CC1=O)CC(C)=O |
| InChI | InChI=1S/C31H50N4O13/c1-3-4-15-48-31(42)33-11-17-44-21-20-43-16-10-32-26(37)23-45-24-30(41)47-19-14-34(22-25(2)36)13-18-46-29(40)7-5-6-12-35-27(38)8-9-28(35)39/h8-9H,3-7,10-24H2,1-2H3,(H,32,37)(H,33,42) |
| InChIKey | VZGNBVUGMPXSQP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|