C11H13BrN2O3 — CID 59771056
methyl 9-bromo-3-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 59771056) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is methyl 9-bromo-3-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 9-bromo-3-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 59771056 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | methyl 9-bromo-3-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc2n(c(=O)c1C)CCCC2Br |
| InChI | InChI=1S/C11H13BrN2O3/c1-6-8(11(16)17-2)13-9-7(12)4-3-5-14(9)10(6)15/h7H,3-5H2,1-2H3 |
| InChIKey | XQACGQQRYXYDHZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|