C24H24N4O3 — CID 59771182
N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 59771182) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 59771182 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(C3CC(=O)N(C)C(=O)C3)cc2C2=CCCCC2)[nH]1 |
| InChI | InChI=1S/C24H24N4O3/c1-3-18-14-25-23(26-18)24(31)27-20-10-9-16(11-19(20)15-7-5-4-6-8-15)17-12-21(29)28(2)22(30)13-17/h1,7,9-11,14,17H,4-6,8,12-13H2,2H3,(H,25,26)(H,27,31) |
| InChIKey | WHZGPINUDCCINR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|