C25H28N4O4 — CID 59771211
N-[2-(4,4-dimethylpiperidin-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-isocyanofuran-2-carboxamide (PubChem CID 59771211) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[2-(4,4-dimethylpiperidin-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-isocyanofuran-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylpiperidin-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-isocyanofuran-2-carboxamide |
|---|---|
| PubChem CID | 59771211 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[2-(4,4-dimethylpiperidin-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-isocyanofuran-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2ccc(C3CC(=O)N(C)C(=O)C3)cc2N2CCC(C)(C)CC2)o1 |
| InChI | InChI=1S/C25H28N4O4/c1-25(2)9-11-29(12-10-25)19-13-16(17-14-22(30)28(4)23(31)15-17)5-6-18(19)27-24(32)20-7-8-21(26-3)33-20/h5-8,13,17H,9-12,14-15H2,1-2,4H3,(H,27,32) |
| InChIKey | BFTMLMVMAYLPAH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|