C17H25N3O2S — CID 59771268
2-(cyclohexen-1-yl)-4-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)aniline (PubChem CID 59771268) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)aniline.
| Compound Name | 2-(cyclohexen-1-yl)-4-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)aniline |
|---|---|
| PubChem CID | 59771268 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)aniline |
| SMILES | CN1CC(c2ccc(N)c(C3=CCCCC3)c2)CN(C)S1(=O)=O |
| InChI | InChI=1S/C17H25N3O2S/c1-19-11-15(12-20(2)23(19,21)22)14-8-9-17(18)16(10-14)13-6-4-3-5-7-13/h6,8-10,15H,3-5,7,11-12,18H2,1-2H3 |
| InChIKey | XHBWEXDXGBMKSB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|