About (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine
(2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine (PubChem CID 59771322) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine.
Molecular Properties
| Compound Name | (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine |
| PubChem CID | 59771322 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine |
| SMILES | CC1CCC(N2C[C@@H](C)O[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C13H25NO/c1-10-4-6-13(7-5-10)14-8-11(2)15-12(3)9-14/h10-13H,4-9H2,1-3H3/t10?,11-,12+,13? |
| InChIKey | PESFXKOAZLDINT-UNTZMWQOSA-N |
| XLogP | 2.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine?
The IUPAC name of (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine (CID 59771322) is (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine.
What is the SMILES notation for (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine?
The canonical SMILES for (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine is CC1CCC(N2C[C@@H](C)O[C@@H](C)C2)CC1.
What is the InChIKey of (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine?
The InChIKey is PESFXKOAZLDINT-UNTZMWQOSA-N. The full InChI is InChI=1S/C13H25NO/c1-10-4-6-13(7-5-10)14-8-11(2)15-12(3)9-14/h10-13H,4-9H2,1-3H3/t10?,11-,12+,13?.
What are the key properties of (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine?
(2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine has a molecular weight of 211.35 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2,6-dimethyl-4-(4-methylcyclohexyl)morpholine is sourced from PubChem (CID 59771322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).