About 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid
3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid (PubChem CID 59771576) has the molecular formula C15H22ClNO3S
and a molecular weight of 331.87 g/mol. Its IUPAC name is 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid |
| PubChem CID | 59771576 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)[C@@H](/C=C/c1ccc(Cl)cc1)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C15H22ClNO3S/c1-12(2)15(17-10-3-11-21(18,19)20)9-6-13-4-7-14(16)8-5-13/h4-9,12,15,17H,3,10-11H2,1-2H3,(H,18,19,20)/b9-6+/t15-/m1/s1 |
| InChIKey | CDYLPTZOWTWEIB-RZIFZGNASA-N |
| XLogP | 3.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid?
The IUPAC name of 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid (CID 59771576) is 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid.
What is the SMILES notation for 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid?
The canonical SMILES for 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid is CC(C)[C@@H](/C=C/c1ccc(Cl)cc1)NCCCS(=O)(=O)O.
What is the InChIKey of 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid?
The InChIKey is CDYLPTZOWTWEIB-RZIFZGNASA-N. The full InChI is InChI=1S/C15H22ClNO3S/c1-12(2)15(17-10-3-11-21(18,19)20)9-6-13-4-7-14(16)8-5-13/h4-9,12,15,17H,3,10-11H2,1-2H3,(H,18,19,20)/b9-6+/t15-/m1/s1.
What are the key properties of 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid?
3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid has a molecular weight of 331.87 g/mol, XLogP of 3.25, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(E,3S)-1-(4-chlorophenyl)-4-methylpent-1-en-3-yl]amino]propane-1-sulfonic acid is sourced from PubChem (CID 59771576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).