C17H26O3P2S — CID 59771854
diethoxyphosphoryl-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethenyl]phosphane (PubChem CID 59771854) has the molecular formula C17H26O3P2S and a molecular weight of 372.41 g/mol. Its IUPAC name is diethoxyphosphoryl-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethenyl]phosphane.
| Compound Name | diethoxyphosphoryl-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethenyl]phosphane |
|---|---|
| PubChem CID | 59771854 |
| Molecular Formula | C17H26O3P2S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | diethoxyphosphoryl-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethenyl]phosphane |
| SMILES | C=C(PP(=O)(OCC)OCC)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C17H26O3P2S/c1-6-19-22(18,20-7-2)21-13(3)14-8-9-16-15(12-14)17(4,5)10-11-23-16/h8-9,12,21H,3,6-7,10-11H2,1-2,4-5H3 |
| InChIKey | KXVLEWHTUICNLB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|