C22H32ClN5O2 — CID 59772567
tert-butyl 4-[(2S)-4-(3-chloro-5-isocyano-2-pyridinyl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate (PubChem CID 59772567) has the molecular formula C22H32ClN5O2 and a molecular weight of 433.98 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-4-(3-chloro-5-isocyano-2-pyridinyl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-4-(3-chloro-5-isocyano-2-pyridinyl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59772567 |
| Molecular Formula | C22H32ClN5O2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | tert-butyl 4-[(2S)-4-(3-chloro-5-isocyano-2-pyridinyl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1cnc(N2CCN(C3CCN(C(=O)OC(C)(C)C)CC3)[C@@H](CC)C2)c(Cl)c1 |
| InChI | InChI=1S/C22H32ClN5O2/c1-6-17-15-27(20-19(23)13-16(24-5)14-25-20)11-12-28(17)18-7-9-26(10-8-18)21(29)30-22(2,3)4/h13-14,17-18H,6-12,15H2,1-4H3/t17-/m0/s1 |
| InChIKey | IKYBITPPQHIBPN-KRWDZBQOSA-N |
| XLogP | 4.59 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|