C14H9BrF3NO2 — CID 59772667
1-(3-bromophenyl)-2-[1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethane-1,2-dione (PubChem CID 59772667) has the molecular formula C14H9BrF3NO2 and a molecular weight of 360.13 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-[1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(3-bromophenyl)-2-[1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 59772667 |
| Molecular Formula | C14H9BrF3NO2 |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 1-(3-bromophenyl)-2-[1-(2,2,2-trifluoroethyl)pyrrol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccn(CC(F)(F)F)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H9BrF3NO2/c15-11-3-1-2-9(6-11)12(20)13(21)10-4-5-19(7-10)8-14(16,17)18/h1-7H,8H2 |
| InChIKey | HMOAXMJBVIMBIY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|