C25H40O5 — CID 59773088
propan-2-yl (Z)-7-[(1R,5S)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 59773088) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,5S)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,5S)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 59773088 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,5S)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCCC1(CC[C@H]2C=CC(=O)[C@@H]2C/C=C\CCCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C25H40O5/c1-4-5-10-16-25(28-18-19-29-25)17-15-21-13-14-23(26)22(21)11-8-6-7-9-12-24(27)30-20(2)3/h6,8,13-14,20-22H,4-5,7,9-12,15-19H2,1-3H3/b8-6-/t21-,22-/m1/s1 |
| InChIKey | WXDYZQMYNGRIIC-PUZSOODZSA-N |
| XLogP | 5.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|