C28H40O6 — CID 59773179
(7R,8R,10R,13S,14S,17R)-7-(2-methoxy-2-propan-2-yloxyacetyl)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 59773179) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is (7R,8R,10R,13S,14S,17R)-7-(2-methoxy-2-propan-2-yloxyacetyl)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (7R,8R,10R,13S,14S,17R)-7-(2-methoxy-2-propan-2-yloxyacetyl)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 59773179 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (7R,8R,10R,13S,14S,17R)-7-(2-methoxy-2-propan-2-yloxyacetyl)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | COC(OC(C)C)C(=O)[C@@H]1CC2=CC(=O)CC[C@]2(C)C2CC[C@@]3(C)[C@@H](CC[C@@]34CCC(=O)O4)[C@@H]21 |
| InChI | InChI=1S/C28H40O6/c1-16(2)33-25(32-5)24(31)19-15-17-14-18(29)6-10-26(17,3)20-7-11-27(4)21(23(19)20)8-12-28(27)13-9-22(30)34-28/h14,16,19-21,23,25H,6-13,15H2,1-5H3/t19-,20?,21+,23-,25?,26+,27+,28-/m1/s1 |
| InChIKey | MIQSKPGMALDGPE-PLUWIDNPSA-N |
| XLogP | 4.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|