C38H34Br4N4Si2 — CID 59773241
[3,5-dibromo-4-[15-(2,6-dibromo-4-trimethylsilylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]-trimethylsilane (PubChem CID 59773241) has the molecular formula C38H34Br4N4Si2 and a molecular weight of 922.51 g/mol. Its IUPAC name is [3,5-dibromo-4-[15-(2,6-dibromo-4-trimethylsilylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]-trimethylsilane.
| Compound Name | [3,5-dibromo-4-[15-(2,6-dibromo-4-trimethylsilylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 59773241 |
| Molecular Formula | C38H34Br4N4Si2 |
| Molecular Weight | 922.51 g/mol |
| Exact Mass | 917.91 |
| IUPAC Name | [3,5-dibromo-4-[15-(2,6-dibromo-4-trimethylsilylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(Br)c(-c2c3nc(cc4ccc([nH]4)c(-c4c(Br)cc([Si](C)(C)C)cc4Br)c4ccc(cc5nc2C=C5)[nH]4)C=C3)c(Br)c1 |
| InChI | InChI=1S/C38H34Br4N4Si2/c1-47(2,3)25-17-27(39)35(28(40)18-25)37-31-11-7-21(43-31)15-23-9-13-33(45-23)38(36-29(41)19-26(20-30(36)42)48(4,5)6)34-14-10-24(46-34)16-22-8-12-32(37)44-22/h7-20,43-44H,1-6H3/b21-15-,22-16-,23-15-,24-16-,37-31+,37-32+,38-33+,38-34+ |
| InChIKey | RUWQSWVACBTBKG-BSPYAILQSA-N |
| XLogP | 12.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.51 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|