About 4-tert-butyl-2,3,5,6-tetrafluoropyridine
4-tert-butyl-2,3,5,6-tetrafluoropyridine (PubChem CID 59773413) has the molecular formula C9H9F4N
and a molecular weight of 207.17 g/mol. Its IUPAC name is 4-tert-butyl-2,3,5,6-tetrafluoropyridine.
Molecular Properties
| Compound Name | 4-tert-butyl-2,3,5,6-tetrafluoropyridine |
| PubChem CID | 59773413 |
| Molecular Formula | C9H9F4N |
| Molecular Weight | 207.17 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 4-tert-butyl-2,3,5,6-tetrafluoropyridine |
| SMILES | CC(C)(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C9H9F4N/c1-9(2,3)4-5(10)7(12)14-8(13)6(4)11/h1-3H3 |
| InChIKey | XCVPUYFHBFBFNS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2,3,5,6-tetrafluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,3,5,6-tetrafluoropyridine?
The IUPAC name of 4-tert-butyl-2,3,5,6-tetrafluoropyridine (CID 59773413) is 4-tert-butyl-2,3,5,6-tetrafluoropyridine.
What is the SMILES notation for 4-tert-butyl-2,3,5,6-tetrafluoropyridine?
The canonical SMILES for 4-tert-butyl-2,3,5,6-tetrafluoropyridine is CC(C)(C)c1c(F)c(F)nc(F)c1F.
What is the InChIKey of 4-tert-butyl-2,3,5,6-tetrafluoropyridine?
The InChIKey is XCVPUYFHBFBFNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F4N/c1-9(2,3)4-5(10)7(12)14-8(13)6(4)11/h1-3H3.
What are the key properties of 4-tert-butyl-2,3,5,6-tetrafluoropyridine?
4-tert-butyl-2,3,5,6-tetrafluoropyridine has a molecular weight of 207.17 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,3,5,6-tetrafluoropyridine is sourced from PubChem (CID 59773413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).