About 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one
7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one (PubChem CID 59773620) has the molecular formula C10H11N5O
and a molecular weight of 217.23 g/mol. Its IUPAC name is 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one.
Molecular Properties
| Compound Name | 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one |
| PubChem CID | 59773620 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one |
| SMILES | CN1C(=O)C(N=[N+]=[N-])CCc2ncccc21 |
| InChI | InChI=1S/C10H11N5O/c1-15-9-3-2-6-12-7(9)4-5-8(10(15)16)13-14-11/h2-3,6,8H,4-5H2,1H3 |
| InChIKey | SIQRMPWBVKBYPH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one?
The IUPAC name of 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one (CID 59773620) is 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one.
What is the SMILES notation for 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one?
The canonical SMILES for 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one is CN1C(=O)C(N=[N+]=[N-])CCc2ncccc21.
What is the InChIKey of 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one?
The InChIKey is SIQRMPWBVKBYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O/c1-15-9-3-2-6-12-7(9)4-5-8(10(15)16)13-14-11/h2-3,6,8H,4-5H2,1H3.
What are the key properties of 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one?
7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one has a molecular weight of 217.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azido-5-methyl-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one is sourced from PubChem (CID 59773620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).