About CID 59773716
CID 59773716 (PubChem CID 59773716) has the molecular formula C18H17BNO
and a molecular weight of 274.15 g/mol.
Molecular Properties
| Compound Name | CID 59773716 |
| PubChem CID | 59773716 |
| Molecular Formula | C18H17BNO |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | — |
| SMILES | CCN1c2ccccc2[B]C1C1Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H17BNO/c1-2-20-16-10-6-5-9-15(16)19-18(20)14-11-12-7-3-4-8-13(12)17(14)21/h3-10,14,18H,2,11H2,1H3 |
| InChIKey | IZJMTNMMSRPKMZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59773716 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59773716?
The IUPAC name of CID 59773716 (CID 59773716) is not available.
What is the SMILES notation for CID 59773716?
The canonical SMILES for CID 59773716 is CCN1c2ccccc2[B]C1C1Cc2ccccc2C1=O.
What is the InChIKey of CID 59773716?
The InChIKey is IZJMTNMMSRPKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BNO/c1-2-20-16-10-6-5-9-15(16)19-18(20)14-11-12-7-3-4-8-13(12)17(14)21/h3-10,14,18H,2,11H2,1H3.
What are the key properties of CID 59773716?
CID 59773716 has a molecular weight of 274.15 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59773716 is sourced from PubChem (CID 59773716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).