About 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one
1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one (PubChem CID 59773729) has the molecular formula C31H44N2O
and a molecular weight of 460.71 g/mol. Its IUPAC name is 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one |
| PubChem CID | 59773729 |
| Molecular Formula | C31H44N2O |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.35 |
| IUPAC Name | 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one |
| SMILES | CCCCN1c2ccccc2C(C)(C)C1CC(=O)CC1N(CCCC)c2ccccc2C1(C)C |
| InChI | InChI=1S/C31H44N2O/c1-7-9-19-32-26-17-13-11-15-24(26)30(3,4)28(32)21-23(34)22-29-31(5,6)25-16-12-14-18-27(25)33(29)20-10-8-2/h11-18,28-29H,7-10,19-22H2,1-6H3 |
| InChIKey | XPYOYPJIPWYRBK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one?
The IUPAC name of 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one (CID 59773729) is 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one.
What is the SMILES notation for 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one?
The canonical SMILES for 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one is CCCCN1c2ccccc2C(C)(C)C1CC(=O)CC1N(CCCC)c2ccccc2C1(C)C.
What is the InChIKey of 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one?
The InChIKey is XPYOYPJIPWYRBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H44N2O/c1-7-9-19-32-26-17-13-11-15-24(26)30(3,4)28(32)21-23(34)22-29-31(5,6)25-16-12-14-18-27(25)33(29)20-10-8-2/h11-18,28-29H,7-10,19-22H2,1-6H3.
What are the key properties of 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one?
1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one has a molecular weight of 460.71 g/mol, XLogP of 7.27, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1-butyl-3,3-dimethyl-2H-indol-2-yl)propan-2-one is sourced from PubChem (CID 59773729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).