About sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate
sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate (PubChem CID 59773749) has the molecular formula C6H10NNaO2
and a molecular weight of 151.14 g/mol. Its IUPAC name is sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate.
Molecular Properties
| Compound Name | sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate |
| PubChem CID | 59773749 |
| Molecular Formula | C6H10NNaO2 |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate |
| SMILES | CC(C[O-])C1=NCCO1.[Na+] |
| InChI | InChI=1S/C6H10NO2.Na/c1-5(4-8)6-7-2-3-9-6;/h5H,2-4H2,1H3;/q-1;+1 |
| InChIKey | BBWPAYLKXYDRPC-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate?
The IUPAC name of sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate (CID 59773749) is sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate.
What is the SMILES notation for sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate?
The canonical SMILES for sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate is CC(C[O-])C1=NCCO1.[Na+].
What is the InChIKey of sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate?
The InChIKey is BBWPAYLKXYDRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10NO2.Na/c1-5(4-8)6-7-2-3-9-6;/h5H,2-4H2,1H3;/q-1;+1.
What are the key properties of sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate?
sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate has a molecular weight of 151.14 g/mol, XLogP of -3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(4,5-dihydro-1,3-oxazol-2-yl)propan-1-olate is sourced from PubChem (CID 59773749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).