C12H23N — CID 59773900
1,2,2-Trimethyl-1-azaspiro[4.5]decane (PubChem CID 59773900) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1,2,2-trimethyl-1-azaspiro[4.5]decane.
| Compound Name | 1,2,2-Trimethyl-1-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 59773900 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1,2,2-trimethyl-1-azaspiro[4.5]decane |
| SMILES | CC1(CCC2(N1C)CCCCC2)C |
| InChI | InChI=1S/C12H23N/c1-11(2)9-10-12(13(11)3)7-5-4-6-8-12/h4-10H2,1-3H3 |
| InChIKey | YGAVIWBBDJNHLQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 189 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |