C21H44N2 — CID 59773902
1-tert-butyl-3,3,5,5-tetraethyl-2,2,4,6,6-pentamethylpiperazine (PubChem CID 59773902) has the molecular formula C21H44N2 and a molecular weight of 324.60 g/mol. Its IUPAC name is 1-tert-butyl-3,3,5,5-tetraethyl-2,2,4,6,6-pentamethylpiperazine.
| Compound Name | 1-tert-butyl-3,3,5,5-tetraethyl-2,2,4,6,6-pentamethylpiperazine |
|---|---|
| PubChem CID | 59773902 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | 1-tert-butyl-3,3,5,5-tetraethyl-2,2,4,6,6-pentamethylpiperazine |
| SMILES | CCC1(CC)N(C)C(CC)(CC)C(C)(C)N(C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C21H44N2/c1-13-20(14-2)18(8,9)23(17(5,6)7)19(10,11)21(15-3,16-4)22(20)12/h13-16H2,1-12H3 |
| InChIKey | BMDUPULOMRYTJQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |