About 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol
3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol (PubChem CID 59774003) has the molecular formula C17H17ClO
and a molecular weight of 272.78 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol.
Molecular Properties
| Compound Name | 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol |
| PubChem CID | 59774003 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol |
| SMILES | C=C(O)Cc1cc(-c2ccc(Cl)cc2)c(C)cc1C |
| InChI | InChI=1S/C17H17ClO/c1-11-8-12(2)17(10-15(11)9-13(3)19)14-4-6-16(18)7-5-14/h4-8,10,19H,3,9H2,1-2H3 |
| InChIKey | RTGDKTALCSOAFL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol?
The IUPAC name of 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol (CID 59774003) is 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol.
What is the SMILES notation for 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol?
The canonical SMILES for 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol is C=C(O)Cc1cc(-c2ccc(Cl)cc2)c(C)cc1C.
What is the InChIKey of 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol?
The InChIKey is RTGDKTALCSOAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClO/c1-11-8-12(2)17(10-15(11)9-13(3)19)14-4-6-16(18)7-5-14/h4-8,10,19H,3,9H2,1-2H3.
What are the key properties of 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol?
3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol has a molecular weight of 272.78 g/mol, XLogP of 5.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-chlorophenyl)-2,4-dimethylphenyl]prop-1-en-2-ol is sourced from PubChem (CID 59774003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).