C18H20F3N5 — CID 59774261
6-N-[(3R,4S)-4-(trifluoromethyl)pyrrolidin-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine (PubChem CID 59774261) has the molecular formula C18H20F3N5 and a molecular weight of 363.39 g/mol. Its IUPAC name is 6-N-[(3R,4S)-4-(trifluoromethyl)pyrrolidin-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine.
| Compound Name | 6-N-[(3R,4S)-4-(trifluoromethyl)pyrrolidin-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
|---|---|
| PubChem CID | 59774261 |
| Molecular Formula | C18H20F3N5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 6-N-[(3R,4S)-4-(trifluoromethyl)pyrrolidin-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
| SMILES | Nc1nc(N[C@H]2CNC[C@@H]2C(F)(F)F)c2c(n1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C18H20F3N5/c19-18(20,21)13-8-23-9-14(13)24-16-12-7-3-5-10-4-1-2-6-11(10)15(12)25-17(22)26-16/h1-2,4,6,13-14,23H,3,5,7-9H2,(H3,22,24,25,26)/t13-,14-/m0/s1 |
| InChIKey | UOFXOVSYQAWSEE-KBPBESRZSA-N |
| XLogP | 2.78 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |