About (Z)-1,2-diphenylethenamine
(Z)-1,2-diphenylethenamine (PubChem CID 59774438) has the molecular formula C14H13N
and a molecular weight of 195.26 g/mol. Its IUPAC name is (Z)-1,2-diphenylethenamine.
Molecular Properties
| Compound Name | (Z)-1,2-diphenylethenamine |
| PubChem CID | 59774438 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (Z)-1,2-diphenylethenamine |
| SMILES | N/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13N/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,15H2/b14-11- |
| InChIKey | XFLTXYRMEZIEOG-KAMYIIQDSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,2-diphenylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-diphenylethenamine?
The IUPAC name of (Z)-1,2-diphenylethenamine (CID 59774438) is (Z)-1,2-diphenylethenamine.
What is the SMILES notation for (Z)-1,2-diphenylethenamine?
The canonical SMILES for (Z)-1,2-diphenylethenamine is N/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-1,2-diphenylethenamine?
The InChIKey is XFLTXYRMEZIEOG-KAMYIIQDSA-N. The full InChI is InChI=1S/C14H13N/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,15H2/b14-11-.
What are the key properties of (Z)-1,2-diphenylethenamine?
(Z)-1,2-diphenylethenamine has a molecular weight of 195.26 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-diphenylethenamine is sourced from PubChem (CID 59774438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).