C19H16FNO2 — CID 59774535
5-fluoro-1-(2-hydroxy-1,2-diphenylethyl)pyridin-2-one (PubChem CID 59774535) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is 5-fluoro-1-(2-hydroxy-1,2-diphenylethyl)pyridin-2-one.
| Compound Name | 5-fluoro-1-(2-hydroxy-1,2-diphenylethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59774535 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 5-fluoro-1-(2-hydroxy-1,2-diphenylethyl)pyridin-2-one |
| SMILES | O=c1ccc(F)cn1C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C19H16FNO2/c20-16-11-12-17(22)21(13-16)18(14-7-3-1-4-8-14)19(23)15-9-5-2-6-10-15/h1-13,18-19,23H |
| InChIKey | KTWRGBNCSJCCKI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |