About CID 59774594
CID 59774594 (PubChem CID 59774594) has the molecular formula C18H18BN3O2
and a molecular weight of 319.17 g/mol.
Molecular Properties
| Compound Name | CID 59774594 |
| PubChem CID | 59774594 |
| Molecular Formula | C18H18BN3O2 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC(=C(c2ccccc2)c2nnc(C3CC3)o2)CC1 |
| InChI | InChI=1S/C18H18BN3O2/c19-18(23)22-10-8-13(9-11-22)15(12-4-2-1-3-5-12)17-21-20-16(24-17)14-6-7-14/h1-5,14H,6-11H2 |
| InChIKey | XBJPNMQOBMXYCM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59774594 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59774594?
The IUPAC name of CID 59774594 (CID 59774594) is not available.
What is the SMILES notation for CID 59774594?
The canonical SMILES for CID 59774594 is [B]C(=O)N1CCC(=C(c2ccccc2)c2nnc(C3CC3)o2)CC1.
What is the InChIKey of CID 59774594?
The InChIKey is XBJPNMQOBMXYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BN3O2/c19-18(23)22-10-8-13(9-11-22)15(12-4-2-1-3-5-12)17-21-20-16(24-17)14-6-7-14/h1-5,14H,6-11H2.
What are the key properties of CID 59774594?
CID 59774594 has a molecular weight of 319.17 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59774594 is sourced from PubChem (CID 59774594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).