C23H19F4N3O3 — CID 59774909
4-(3-fluorophenyl)-7-[[5-methyl-4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)triazol-1-yl]methyl]chromen-2-one (PubChem CID 59774909) has the molecular formula C23H19F4N3O3 and a molecular weight of 461.42 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-7-[[5-methyl-4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)triazol-1-yl]methyl]chromen-2-one.
| Compound Name | 4-(3-fluorophenyl)-7-[[5-methyl-4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)triazol-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 59774909 |
| Molecular Formula | C23H19F4N3O3 |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 4-(3-fluorophenyl)-7-[[5-methyl-4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)triazol-1-yl]methyl]chromen-2-one |
| SMILES | CCC(O)(c1nnn(Cc2ccc3c(-c4cccc(F)c4)cc(=O)oc3c2)c1C)C(F)(F)F |
| InChI | InChI=1S/C23H19F4N3O3/c1-3-22(32,23(25,26)27)21-13(2)30(29-28-21)12-14-7-8-17-18(11-20(31)33-19(17)9-14)15-5-4-6-16(24)10-15/h4-11,32H,3,12H2,1-2H3 |
| InChIKey | HYCRLMWKKQNEHV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|