About [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium
[methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium (PubChem CID 59775368) has the molecular formula C3H10O3P2WY
and a molecular weight of 428.80 g/mol. Its IUPAC name is [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium.
Molecular Properties
| Compound Name | [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium |
| PubChem CID | 59775368 |
| Molecular Formula | C3H10O3P2WY |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.87 |
| IUPAC Name | [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium |
| SMILES | COP(C)CP(O)O.[W].[Y] |
| InChI | InChI=1S/C3H10O3P2.W.Y/c1-6-7(2)3-8(4)5;;/h4-5H,3H2,1-2H3;; |
| InChIKey | WSTBJALXHZFDIB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium?
The IUPAC name of [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium (CID 59775368) is [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium.
What is the SMILES notation for [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium?
The canonical SMILES for [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium is COP(C)CP(O)O.[W].[Y].
What is the InChIKey of [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium?
The InChIKey is WSTBJALXHZFDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3P2.W.Y/c1-6-7(2)3-8(4)5;;/h4-5H,3H2,1-2H3;;.
What are the key properties of [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium?
[methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium has a molecular weight of 428.80 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [methoxy(methyl)phosphanyl]methylphosphonous acid;tungsten;yttrium is sourced from PubChem (CID 59775368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).