C33H37B2FN4O5+2 — CID 59775391
[2-[[4-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid (PubChem CID 59775391) has the molecular formula C33H37B2FN4O5+2 and a molecular weight of 610.30 g/mol. Its IUPAC name is [2-[[4-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[4-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 59775391 |
| Molecular Formula | C33H37B2FN4O5+2 |
| Molecular Weight | 610.30 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | [2-[[4-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid |
| SMILES | C=C(C)C(=C)NCCCNC(=O)c1cc(-c2cc[n+](Cc3ccccc3B(O)O)cc2)c[n+](Cc2cc(F)ccc2B(O)O)c1 |
| InChI | InChI=1S/C33H36B2FN4O5/c1-23(2)24(3)37-13-6-14-38-33(41)29-17-27(20-40(22-29)21-28-18-30(36)9-10-32(28)35(44)45)25-11-15-39(16-12-25)19-26-7-4-5-8-31(26)34(42)43/h4-5,7-12,15-18,20,22,37,42-45H,1,3,6,13-14,19,21H2,2H3/q+1/p+1 |
| InChIKey | AFHPYTFUORIPRV-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|