C33H36B2F2N4O5+2 — CID 59775396
[2-[[3-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]-4-fluorophenyl]boronic acid (PubChem CID 59775396) has the molecular formula C33H36B2F2N4O5+2 and a molecular weight of 628.29 g/mol. Its IUPAC name is [2-[[3-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]-4-fluorophenyl]boronic acid.
| Compound Name | [2-[[3-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]-4-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 59775396 |
| Molecular Formula | C33H36B2F2N4O5+2 |
| Molecular Weight | 628.29 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | [2-[[3-[1-[(2-borono-5-fluorophenyl)methyl]-5-[3-(3-methylbuta-1,3-dien-2-ylamino)propylcarbamoyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]-4-fluorophenyl]boronic acid |
| SMILES | C=C(C)C(=C)NCCCNC(=O)c1cc(-c2ccc[n+](Cc3cc(F)ccc3B(O)O)c2)c[n+](Cc2cc(F)ccc2B(O)O)c1 |
| InChI | InChI=1S/C33H35B2F2N4O5/c1-22(2)23(3)38-11-5-12-39-33(42)28-14-25(18-41(21-28)20-27-16-30(37)8-10-32(27)35(45)46)24-6-4-13-40(17-24)19-26-15-29(36)7-9-31(26)34(43)44/h4,6-10,13-18,21,38,43-46H,1,3,5,11-12,19-20H2,2H3/q+1/p+1 |
| InChIKey | JGZDLQQFLPQSQK-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|