About benzyl-methyl-(2,4,6-trimethylphenyl)phosphane
benzyl-methyl-(2,4,6-trimethylphenyl)phosphane (PubChem CID 59775575) has the molecular formula C17H21P
and a molecular weight of 256.33 g/mol. Its IUPAC name is benzyl-methyl-(2,4,6-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | benzyl-methyl-(2,4,6-trimethylphenyl)phosphane |
| PubChem CID | 59775575 |
| Molecular Formula | C17H21P |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | benzyl-methyl-(2,4,6-trimethylphenyl)phosphane |
| SMILES | Cc1cc(C)c(P(C)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H21P/c1-13-10-14(2)17(15(3)11-13)18(4)12-16-8-6-5-7-9-16/h5-11H,12H2,1-4H3 |
| InChIKey | WFIMMYKHIDMOHM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl-methyl-(2,4,6-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-methyl-(2,4,6-trimethylphenyl)phosphane?
The IUPAC name of benzyl-methyl-(2,4,6-trimethylphenyl)phosphane (CID 59775575) is benzyl-methyl-(2,4,6-trimethylphenyl)phosphane.
What is the SMILES notation for benzyl-methyl-(2,4,6-trimethylphenyl)phosphane?
The canonical SMILES for benzyl-methyl-(2,4,6-trimethylphenyl)phosphane is Cc1cc(C)c(P(C)Cc2ccccc2)c(C)c1.
What is the InChIKey of benzyl-methyl-(2,4,6-trimethylphenyl)phosphane?
The InChIKey is WFIMMYKHIDMOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21P/c1-13-10-14(2)17(15(3)11-13)18(4)12-16-8-6-5-7-9-16/h5-11H,12H2,1-4H3.
What are the key properties of benzyl-methyl-(2,4,6-trimethylphenyl)phosphane?
benzyl-methyl-(2,4,6-trimethylphenyl)phosphane has a molecular weight of 256.33 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-methyl-(2,4,6-trimethylphenyl)phosphane is sourced from PubChem (CID 59775575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).